About 2-aminopropan-1-ol;hydrofluoride
2-aminopropan-1-ol;hydrofluoride (PubChem CID 22617394) has the molecular formula C3H10FNO
and a molecular weight of 95.12 g/mol. Its IUPAC name is 2-aminopropan-1-ol;hydrofluoride.
Molecular Properties
| Compound Name | 2-aminopropan-1-ol;hydrofluoride |
| PubChem CID | 22617394 |
| Molecular Formula | C3H10FNO |
| Molecular Weight | 95.12 g/mol |
| Exact Mass | 95.07 |
| IUPAC Name | 2-aminopropan-1-ol;hydrofluoride |
| SMILES | CC(N)CO.F |
| InChI | InChI=1S/C3H9NO.FH/c1-3(4)2-5;/h3,5H,2,4H2,1H3;1H |
| InChIKey | PFTZXPBCEVJEEB-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 95.12 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-aminopropan-1-ol;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopropan-1-ol;hydrofluoride?
The IUPAC name of 2-aminopropan-1-ol;hydrofluoride (CID 22617394) is 2-aminopropan-1-ol;hydrofluoride.
What is the SMILES notation for 2-aminopropan-1-ol;hydrofluoride?
The canonical SMILES for 2-aminopropan-1-ol;hydrofluoride is CC(N)CO.F.
What is the InChIKey of 2-aminopropan-1-ol;hydrofluoride?
The InChIKey is PFTZXPBCEVJEEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9NO.FH/c1-3(4)2-5;/h3,5H,2,4H2,1H3;1H.
What are the key properties of 2-aminopropan-1-ol;hydrofluoride?
2-aminopropan-1-ol;hydrofluoride has a molecular weight of 95.12 g/mol, XLogP of -0.52, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopropan-1-ol;hydrofluoride is sourced from PubChem (CID 22617394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).