C7H17NO — CID 167005595
(2R,5R)-5-amino-2-methylhexan-1-ol (PubChem CID 167005595) has the molecular formula C7H17NO and a molecular weight of 131.22 g/mol. Its IUPAC name is (2R,5R)-5-amino-2-methylhexan-1-ol.
| Compound Name | (2R,5R)-5-amino-2-methylhexan-1-ol |
|---|---|
| PubChem CID | 167005595 |
| Molecular Formula | C7H17NO |
| Molecular Weight | 131.22 g/mol |
| Exact Mass | 131.13 |
| IUPAC Name | (2R,5R)-5-amino-2-methylhexan-1-ol |
| SMILES | C[C@@H](CO)CC[C@@H](C)N |
| InChI | InChI=1S/C7H17NO/c1-6(5-9)3-4-7(2)8/h6-7,9H,3-5,8H2,1-2H3/t6-,7-/m1/s1 |
| InChIKey | DFFJFMBKGILHPQ-RNFRBKRXSA-N |
| XLogP | 0.74 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |