C9H20O2 — CID 12653721
2,6-dimethylheptane-1,7-diol (PubChem CID 12653721) has the molecular formula C9H20O2 and a molecular weight of 160.26 g/mol. Its IUPAC name is 2,6-dimethylheptane-1,7-diol.
| Compound Name | 2,6-dimethylheptane-1,7-diol |
|---|---|
| PubChem CID | 12653721 |
| Molecular Formula | C9H20O2 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.15 |
| IUPAC Name | 2,6-dimethylheptane-1,7-diol |
| SMILES | CC(CO)CCCC(C)CO |
| InChI | InChI=1S/C9H20O2/c1-8(6-10)4-3-5-9(2)7-11/h8-11H,3-7H2,1-2H3 |
| InChIKey | OJGZGRBLINGMOG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |