About 2,6-dimethyldodecan-1-ol
2,6-dimethyldodecan-1-ol (PubChem CID 14392571) has the molecular formula C14H30O
and a molecular weight of 214.39 g/mol. Its IUPAC name is 2,6-dimethyldodecan-1-ol.
Molecular Properties
| Compound Name | 2,6-dimethyldodecan-1-ol |
| PubChem CID | 14392571 |
| Molecular Formula | C14H30O |
| Molecular Weight | 214.39 g/mol |
| Exact Mass | 214.23 |
| IUPAC Name | 2,6-dimethyldodecan-1-ol |
| SMILES | CCCCCCC(C)CCCC(C)CO |
| InChI | InChI=1S/C14H30O/c1-4-5-6-7-9-13(2)10-8-11-14(3)12-15/h13-15H,4-12H2,1-3H3 |
| InChIKey | VSUINCXVORTITQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.39 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethyldodecan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyldodecan-1-ol?
The IUPAC name of 2,6-dimethyldodecan-1-ol (CID 14392571) is 2,6-dimethyldodecan-1-ol.
What is the SMILES notation for 2,6-dimethyldodecan-1-ol?
The canonical SMILES for 2,6-dimethyldodecan-1-ol is CCCCCCC(C)CCCC(C)CO.
What is the InChIKey of 2,6-dimethyldodecan-1-ol?
The InChIKey is VSUINCXVORTITQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O/c1-4-5-6-7-9-13(2)10-8-11-14(3)12-15/h13-15H,4-12H2,1-3H3.
What are the key properties of 2,6-dimethyldodecan-1-ol?
2,6-dimethyldodecan-1-ol has a molecular weight of 214.39 g/mol, XLogP of 4.39, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyldodecan-1-ol is sourced from PubChem (CID 14392571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).