C14H32O5S — CID 87950586
2,6-dimethyldodecan-1-ol;sulfuric acid (PubChem CID 87950586) has the molecular formula C14H32O5S and a molecular weight of 312.47 g/mol. Its IUPAC name is 2,6-dimethyldodecan-1-ol;sulfuric acid.
| Compound Name | 2,6-dimethyldodecan-1-ol;sulfuric acid |
|---|---|
| PubChem CID | 87950586 |
| Molecular Formula | C14H32O5S |
| Molecular Weight | 312.47 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 2,6-dimethyldodecan-1-ol;sulfuric acid |
| SMILES | CCCCCCC(C)CCCC(C)CO.O=S(=O)(O)O |
| InChI | InChI=1S/C14H30O.H2O4S/c1-4-5-6-7-9-13(2)10-8-11-14(3)12-15;1-5(2,3)4/h13-15H,4-12H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | PSDSXRPNBJJXIS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|