5-methyldodecan-1-ol;sulfuric acid

C13H30O5S — CID 87950603

IUPAC5-methyldodecan-1-ol;sulfuric acid
SMILESCCCCCCCC(C)CCCCO.O=S(=O)(O)O
InChIInChI=1S/C13H28O.H2O4S/c1-3-4-5-6-7-10-13(2)11-8-9-12-14;1-5(2,3)4/h13-14H,3-12H2,1-2H3;(H2,1,2,3,4)
InChIKeyMXYSDXFLUXRPMN-UHFFFAOYSA-N
MW298.44 g/mol
LogP3.49
Rot. Bonds10

About 5-methyldodecan-1-ol;sulfuric acid

5-methyldodecan-1-ol;sulfuric acid (PubChem CID 87950603) has the molecular formula C13H30O5S and a molecular weight of 298.44 g/mol. Its IUPAC name is 5-methyldodecan-1-ol;sulfuric acid.

Molecular Properties

Compound Name5-methyldodecan-1-ol;sulfuric acid
PubChem CID87950603
Molecular FormulaC13H30O5S
Molecular Weight298.44 g/mol
Exact Mass298.18
IUPAC Name5-methyldodecan-1-ol;sulfuric acid
SMILESCCCCCCCC(C)CCCCO.O=S(=O)(O)O
InChIInChI=1S/C13H28O.H2O4S/c1-3-4-5-6-7-10-13(2)11-8-9-12-14;1-5(2,3)4/h13-14H,3-12H2,1-2H3;(H2,1,2,3,4)
InChIKeyMXYSDXFLUXRPMN-UHFFFAOYSA-N
XLogP3.49
TPSA94.83 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds10
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.44
LogP ≤ 53.49
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 5-methyldodecan-1-ol;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-methyldodecan-1-ol;sulfuric acid?
The IUPAC name of 5-methyldodecan-1-ol;sulfuric acid (CID 87950603) is 5-methyldodecan-1-ol;sulfuric acid.
What is the SMILES notation for 5-methyldodecan-1-ol;sulfuric acid?
The canonical SMILES for 5-methyldodecan-1-ol;sulfuric acid is CCCCCCCC(C)CCCCO.O=S(=O)(O)O.
What is the InChIKey of 5-methyldodecan-1-ol;sulfuric acid?
The InChIKey is MXYSDXFLUXRPMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O.H2O4S/c1-3-4-5-6-7-10-13(2)11-8-9-12-14;1-5(2,3)4/h13-14H,3-12H2,1-2H3;(H2,1,2,3,4).
What are the key properties of 5-methyldodecan-1-ol;sulfuric acid?
5-methyldodecan-1-ol;sulfuric acid has a molecular weight of 298.44 g/mol, XLogP of 3.49, 10 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyldodecan-1-ol;sulfuric acid is sourced from PubChem (CID 87950603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).