About 5-methyldodecan-1-ol;sulfuric acid
5-methyldodecan-1-ol;sulfuric acid (PubChem CID 87950603) has the molecular formula C13H30O5S
and a molecular weight of 298.44 g/mol. Its IUPAC name is 5-methyldodecan-1-ol;sulfuric acid.
Molecular Properties
| Compound Name | 5-methyldodecan-1-ol;sulfuric acid |
| PubChem CID | 87950603 |
| Molecular Formula | C13H30O5S |
| Molecular Weight | 298.44 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 5-methyldodecan-1-ol;sulfuric acid |
| SMILES | CCCCCCCC(C)CCCCO.O=S(=O)(O)O |
| InChI | InChI=1S/C13H28O.H2O4S/c1-3-4-5-6-7-10-13(2)11-8-9-12-14;1-5(2,3)4/h13-14H,3-12H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | MXYSDXFLUXRPMN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 5-methyldodecan-1-ol;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyldodecan-1-ol;sulfuric acid?
The IUPAC name of 5-methyldodecan-1-ol;sulfuric acid (CID 87950603) is 5-methyldodecan-1-ol;sulfuric acid.
What is the SMILES notation for 5-methyldodecan-1-ol;sulfuric acid?
The canonical SMILES for 5-methyldodecan-1-ol;sulfuric acid is CCCCCCCC(C)CCCCO.O=S(=O)(O)O.
What is the InChIKey of 5-methyldodecan-1-ol;sulfuric acid?
The InChIKey is MXYSDXFLUXRPMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O.H2O4S/c1-3-4-5-6-7-10-13(2)11-8-9-12-14;1-5(2,3)4/h13-14H,3-12H2,1-2H3;(H2,1,2,3,4).
What are the key properties of 5-methyldodecan-1-ol;sulfuric acid?
5-methyldodecan-1-ol;sulfuric acid has a molecular weight of 298.44 g/mol, XLogP of 3.49, 10 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyldodecan-1-ol;sulfuric acid is sourced from PubChem (CID 87950603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).