About 10-methylpentadecan-1-ol sulfate
10-methylpentadecan-1-ol sulfate (PubChem CID 22027470) has the molecular formula C16H34O5S-2
and a molecular weight of 338.51 g/mol. Its IUPAC name is 10-methylpentadecan-1-ol sulfate.
Molecular Properties
| Compound Name | 10-methylpentadecan-1-ol sulfate |
| PubChem CID | 22027470 |
| Molecular Formula | C16H34O5S-2 |
| Molecular Weight | 338.51 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 10-methylpentadecan-1-ol sulfate |
| SMILES | CCCCCC(C)CCCCCCCCCO.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/C16H34O.H2O4S/c1-3-4-10-13-16(2)14-11-8-6-5-7-9-12-15-17;1-5(2,3)4/h16-17H,3-15H2,1-2H3;(H2,1,2,3,4)/p-2 |
| InChIKey | GKHYHMDOQDSOIL-UHFFFAOYSA-L |
| XLogP | 3.98 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze 10-methylpentadecan-1-ol sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methylpentadecan-1-ol sulfate?
The IUPAC name of 10-methylpentadecan-1-ol sulfate (CID 22027470) is 10-methylpentadecan-1-ol sulfate.
What is the SMILES notation for 10-methylpentadecan-1-ol sulfate?
The canonical SMILES for 10-methylpentadecan-1-ol sulfate is CCCCCC(C)CCCCCCCCCO.O=S(=O)([O-])[O-].
What is the InChIKey of 10-methylpentadecan-1-ol sulfate?
The InChIKey is GKHYHMDOQDSOIL-UHFFFAOYSA-L. The full InChI is InChI=1S/C16H34O.H2O4S/c1-3-4-10-13-16(2)14-11-8-6-5-7-9-12-15-17;1-5(2,3)4/h16-17H,3-15H2,1-2H3;(H2,1,2,3,4)/p-2.
What are the key properties of 10-methylpentadecan-1-ol sulfate?
10-methylpentadecan-1-ol sulfate has a molecular weight of 338.51 g/mol, XLogP of 3.98, 13 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methylpentadecan-1-ol sulfate is sourced from PubChem (CID 22027470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).