About 6-methyltridecan-1-ol sulfate
6-methyltridecan-1-ol sulfate (PubChem CID 18328646) has the molecular formula C14H30O5S-2
and a molecular weight of 310.46 g/mol. Its IUPAC name is 6-methyltridecan-1-ol sulfate.
Molecular Properties
| Compound Name | 6-methyltridecan-1-ol sulfate |
| PubChem CID | 18328646 |
| Molecular Formula | C14H30O5S-2 |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 6-methyltridecan-1-ol sulfate |
| SMILES | CCCCCCCC(C)CCCCCO.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/C14H30O.H2O4S/c1-3-4-5-6-8-11-14(2)12-9-7-10-13-15;1-5(2,3)4/h14-15H,3-13H2,1-2H3;(H2,1,2,3,4)/p-2 |
| InChIKey | JSYXGBCESXTQJO-UHFFFAOYSA-L |
| XLogP | 3.20 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze 6-methyltridecan-1-ol sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyltridecan-1-ol sulfate?
The IUPAC name of 6-methyltridecan-1-ol sulfate (CID 18328646) is 6-methyltridecan-1-ol sulfate.
What is the SMILES notation for 6-methyltridecan-1-ol sulfate?
The canonical SMILES for 6-methyltridecan-1-ol sulfate is CCCCCCCC(C)CCCCCO.O=S(=O)([O-])[O-].
What is the InChIKey of 6-methyltridecan-1-ol sulfate?
The InChIKey is JSYXGBCESXTQJO-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H30O.H2O4S/c1-3-4-5-6-8-11-14(2)12-9-7-10-13-15;1-5(2,3)4/h14-15H,3-13H2,1-2H3;(H2,1,2,3,4)/p-2.
What are the key properties of 6-methyltridecan-1-ol sulfate?
6-methyltridecan-1-ol sulfate has a molecular weight of 310.46 g/mol, XLogP of 3.20, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyltridecan-1-ol sulfate is sourced from PubChem (CID 18328646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).