C13H28O5S-2 — CID 18328618
2,7-dimethylundecan-1-ol sulfate (PubChem CID 18328618) has the molecular formula C13H28O5S-2 and a molecular weight of 296.43 g/mol. Its IUPAC name is 2,7-dimethylundecan-1-ol sulfate.
| Compound Name | 2,7-dimethylundecan-1-ol sulfate |
|---|---|
| PubChem CID | 18328618 |
| Molecular Formula | C13H28O5S-2 |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2,7-dimethylundecan-1-ol sulfate |
| SMILES | CCCCC(C)CCCCC(C)CO.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/C13H28O.H2O4S/c1-4-5-8-12(2)9-6-7-10-13(3)11-14;1-5(2,3)4/h12-14H,4-11H2,1-3H3;(H2,1,2,3,4)/p-2 |
| InChIKey | MBMOUDWPFUZJCD-UHFFFAOYSA-L |
| XLogP | 2.66 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|