About azane;4-methylhexadecane;sulfuric acid
azane;4-methylhexadecane;sulfuric acid (PubChem CID 174730502) has the molecular formula C17H41NO4S
and a molecular weight of 355.59 g/mol. Its IUPAC name is azane;4-methylhexadecane;sulfuric acid.
Molecular Properties
| Compound Name | azane;4-methylhexadecane;sulfuric acid |
| PubChem CID | 174730502 |
| Molecular Formula | C17H41NO4S |
| Molecular Weight | 355.59 g/mol |
| Exact Mass | 355.28 |
| IUPAC Name | azane;4-methylhexadecane;sulfuric acid |
| SMILES | CCCCCCCCCCCCC(C)CCC.N.O=S(=O)(O)O |
| InChI | InChI=1S/C17H36.H3N.H2O4S/c1-4-6-7-8-9-10-11-12-13-14-16-17(3)15-5-2;;1-5(2,3)4/h17H,4-16H2,1-3H3;1H3;(H2,1,2,3,4) |
| InChIKey | GHGJIZKNOGCAOB-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 109.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.59 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azane;4-methylhexadecane;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;4-methylhexadecane;sulfuric acid?
The IUPAC name of azane;4-methylhexadecane;sulfuric acid (CID 174730502) is azane;4-methylhexadecane;sulfuric acid.
What is the SMILES notation for azane;4-methylhexadecane;sulfuric acid?
The canonical SMILES for azane;4-methylhexadecane;sulfuric acid is CCCCCCCCCCCCC(C)CCC.N.O=S(=O)(O)O.
What is the InChIKey of azane;4-methylhexadecane;sulfuric acid?
The InChIKey is GHGJIZKNOGCAOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36.H3N.H2O4S/c1-4-6-7-8-9-10-11-12-13-14-16-17(3)15-5-2;;1-5(2,3)4/h17H,4-16H2,1-3H3;1H3;(H2,1,2,3,4).
What are the key properties of azane;4-methylhexadecane;sulfuric acid?
azane;4-methylhexadecane;sulfuric acid has a molecular weight of 355.59 g/mol, XLogP of 6.24, 13 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4-methylhexadecane;sulfuric acid is sourced from PubChem (CID 174730502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).