C19H40O — CID 170847769
(2R,6R,10R)-2,6,10,14-tetramethylpentadecan-1-ol (PubChem CID 170847769) has the molecular formula C19H40O and a molecular weight of 284.53 g/mol. Its IUPAC name is (2R,6R,10R)-2,6,10,14-tetramethylpentadecan-1-ol.
| Compound Name | (2R,6R,10R)-2,6,10,14-tetramethylpentadecan-1-ol |
|---|---|
| PubChem CID | 170847769 |
| Molecular Formula | C19H40O |
| Molecular Weight | 284.53 g/mol |
| Exact Mass | 284.31 |
| IUPAC Name | (2R,6R,10R)-2,6,10,14-tetramethylpentadecan-1-ol |
| SMILES | CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@@H](C)CO |
| InChI | InChI=1S/C19H40O/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-19(5)15-20/h16-20H,6-15H2,1-5H3/t17-,18-,19-/m1/s1 |
| InChIKey | XSGXSLWSZWYHER-GUDVDZBRSA-N |
| XLogP | 6.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.53 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |