C12H28O2 — CID 175190567
3,7-dimethyloctan-1-ol;ethanol (PubChem CID 175190567) has the molecular formula C12H28O2 and a molecular weight of 204.35 g/mol. Its IUPAC name is 3,7-dimethyloctan-1-ol;ethanol.
| Compound Name | 3,7-dimethyloctan-1-ol;ethanol |
|---|---|
| PubChem CID | 175190567 |
| Molecular Formula | C12H28O2 |
| Molecular Weight | 204.35 g/mol |
| Exact Mass | 204.21 |
| IUPAC Name | 3,7-dimethyloctan-1-ol;ethanol |
| SMILES | CC(C)CCCC(C)CCO.CCO |
| InChI | InChI=1S/C10H22O.C2H6O/c1-9(2)5-4-6-10(3)7-8-11;1-2-3/h9-11H,4-8H2,1-3H3;3H,2H2,1H3 |
| InChIKey | OZTMBKTVKDTGTF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |