About 3-methyldecane-1,10-diol
3-methyldecane-1,10-diol (PubChem CID 22596513) has the molecular formula C11H24O2
and a molecular weight of 188.31 g/mol. Its IUPAC name is 3-methyldecane-1,10-diol.
Molecular Properties
| Compound Name | 3-methyldecane-1,10-diol |
| PubChem CID | 22596513 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | 3-methyldecane-1,10-diol |
| SMILES | CC(CCO)CCCCCCCO |
| InChI | InChI=1S/C11H24O2/c1-11(8-10-13)7-5-3-2-4-6-9-12/h11-13H,2-10H2,1H3 |
| InChIKey | IVAVWMHMKCYKEQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methyldecane-1,10-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyldecane-1,10-diol?
The IUPAC name of 3-methyldecane-1,10-diol (CID 22596513) is 3-methyldecane-1,10-diol.
What is the SMILES notation for 3-methyldecane-1,10-diol?
The canonical SMILES for 3-methyldecane-1,10-diol is CC(CCO)CCCCCCCO.
What is the InChIKey of 3-methyldecane-1,10-diol?
The InChIKey is IVAVWMHMKCYKEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O2/c1-11(8-10-13)7-5-3-2-4-6-9-12/h11-13H,2-10H2,1H3.
What are the key properties of 3-methyldecane-1,10-diol?
3-methyldecane-1,10-diol has a molecular weight of 188.31 g/mol, XLogP of 2.34, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyldecane-1,10-diol is sourced from PubChem (CID 22596513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).