C21H44O2 — CID 58388501
(4S,6S)-4,6,9-trimethyloctadecane-1,18-diol (PubChem CID 58388501) has the molecular formula C21H44O2 and a molecular weight of 328.58 g/mol. Its IUPAC name is (4S,6S)-4,6,9-trimethyloctadecane-1,18-diol.
| Compound Name | (4S,6S)-4,6,9-trimethyloctadecane-1,18-diol |
|---|---|
| PubChem CID | 58388501 |
| Molecular Formula | C21H44O2 |
| Molecular Weight | 328.58 g/mol |
| Exact Mass | 328.33 |
| IUPAC Name | (4S,6S)-4,6,9-trimethyloctadecane-1,18-diol |
| SMILES | CC(CCCCCCCCCO)CC[C@H](C)C[C@@H](C)CCCO |
| InChI | InChI=1S/C21H44O2/c1-19(12-9-7-5-4-6-8-10-16-22)14-15-21(3)18-20(2)13-11-17-23/h19-23H,4-18H2,1-3H3/t19?,20-,21-/m0/s1 |
| InChIKey | AMUXIDAJEFKERJ-AKQSQHNNSA-N |
| XLogP | 5.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.58 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|