C21H44ClNO — CID 58388493
(4S,6S)-18-(chloroamino)-4,6,9-trimethyloctadecan-1-ol (PubChem CID 58388493) has the molecular formula C21H44ClNO and a molecular weight of 362.04 g/mol. Its IUPAC name is (4S,6S)-18-(chloroamino)-4,6,9-trimethyloctadecan-1-ol.
| Compound Name | (4S,6S)-18-(chloroamino)-4,6,9-trimethyloctadecan-1-ol |
|---|---|
| PubChem CID | 58388493 |
| Molecular Formula | C21H44ClNO |
| Molecular Weight | 362.04 g/mol |
| Exact Mass | 361.31 |
| IUPAC Name | (4S,6S)-18-(chloroamino)-4,6,9-trimethyloctadecan-1-ol |
| SMILES | CC(CCCCCCCCCNCl)CC[C@H](C)C[C@@H](C)CCCO |
| InChI | InChI=1S/C21H44ClNO/c1-19(12-9-7-5-4-6-8-10-16-23-22)14-15-21(3)18-20(2)13-11-17-24/h19-21,23-24H,4-18H2,1-3H3/t19?,20-,21-/m0/s1 |
| InChIKey | GYWMSHZLJUAIKM-AKQSQHNNSA-N |
| XLogP | 6.70 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.04 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|