C18H38O — CID 11196523
(7R,9S)-7,9-dimethylhexadecan-1-ol (PubChem CID 11196523) has the molecular formula C18H38O and a molecular weight of 270.50 g/mol. Its IUPAC name is (7R,9S)-7,9-dimethylhexadecan-1-ol.
| Compound Name | (7R,9S)-7,9-dimethylhexadecan-1-ol |
|---|---|
| PubChem CID | 11196523 |
| Molecular Formula | C18H38O |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.29 |
| IUPAC Name | (7R,9S)-7,9-dimethylhexadecan-1-ol |
| SMILES | CCCCCCC[C@H](C)C[C@H](C)CCCCCCO |
| InChI | InChI=1S/C18H38O/c1-4-5-6-7-10-13-17(2)16-18(3)14-11-8-9-12-15-19/h17-19H,4-16H2,1-3H3/t17-,18+/m0/s1 |
| InChIKey | AUXXTEDUWXDSOB-ZWKOTPCHSA-N |
| XLogP | 5.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|