C22H46O2 — CID 170848864
8,12-dimethylicosane-1,20-diol (PubChem CID 170848864) has the molecular formula C22H46O2 and a molecular weight of 342.61 g/mol. Its IUPAC name is 8,12-dimethylicosane-1,20-diol.
| Compound Name | 8,12-dimethylicosane-1,20-diol |
|---|---|
| PubChem CID | 170848864 |
| Molecular Formula | C22H46O2 |
| Molecular Weight | 342.61 g/mol |
| Exact Mass | 342.35 |
| IUPAC Name | 8,12-dimethylicosane-1,20-diol |
| SMILES | CC(CCCCCCCO)CCCC(C)CCCCCCCCO |
| InChI | InChI=1S/C22H46O2/c1-21(15-10-6-3-4-8-12-19-23)17-14-18-22(2)16-11-7-5-9-13-20-24/h21-24H,3-20H2,1-2H3 |
| InChIKey | OFGKMTIGBKLUDU-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.61 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|