C35H72 — CID 6428605
2,6,10,14,18,22,26-heptamethyloctacosane (PubChem CID 6428605) has the molecular formula C35H72 and a molecular weight of 492.96 g/mol. Its IUPAC name is 2,6,10,14,18,22,26-heptamethyloctacosane.
| Compound Name | 2,6,10,14,18,22,26-heptamethyloctacosane |
|---|---|
| PubChem CID | 6428605 |
| Molecular Formula | C35H72 |
| Molecular Weight | 492.96 g/mol |
| Exact Mass | 492.56 |
| IUPAC Name | 2,6,10,14,18,22,26-heptamethyloctacosane |
| SMILES | CCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C35H72/c1-10-30(4)18-12-20-32(6)22-14-24-34(8)26-16-28-35(9)27-15-25-33(7)23-13-21-31(5)19-11-17-29(2)3/h29-35H,10-28H2,1-9H3 |
| InChIKey | RBRPLJVTWBTAFB-UHFFFAOYSA-N |
| XLogP | 12.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 25 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.96 |
| LogP ≤ 5 | 12.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |