C15H30 — CID 123657363
2,11-dimethyltridec-6-ene (PubChem CID 123657363) has the molecular formula C15H30 and a molecular weight of 210.41 g/mol. Its IUPAC name is 2,11-dimethyltridec-6-ene.
| Compound Name | 2,11-dimethyltridec-6-ene |
|---|---|
| PubChem CID | 123657363 |
| Molecular Formula | C15H30 |
| Molecular Weight | 210.41 g/mol |
| Exact Mass | 210.23 |
| IUPAC Name | 2,11-dimethyltridec-6-ene |
| SMILES | CCC(C)CCCC=CCCCC(C)C |
| InChI | InChI=1S/C15H30/c1-5-15(4)13-11-9-7-6-8-10-12-14(2)3/h6-7,14-15H,5,8-13H2,1-4H3 |
| InChIKey | MVYBGNRRVUKTCD-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.41 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|