About magnesium;2,6-dimethyloctane;dibromide
magnesium;2,6-dimethyloctane;dibromide (PubChem CID 175146229) has the molecular formula C10H22Br2Mg
and a molecular weight of 326.40 g/mol. Its IUPAC name is magnesium;2,6-dimethyloctane;dibromide.
Molecular Properties
| Compound Name | magnesium;2,6-dimethyloctane;dibromide |
| PubChem CID | 175146229 |
| Molecular Formula | C10H22Br2Mg |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | magnesium;2,6-dimethyloctane;dibromide |
| SMILES | CCC(C)CCCC(C)C.[Br-].[Br-].[Mg+2] |
| InChI | InChI=1S/C10H22.2BrH.Mg/c1-5-10(4)8-6-7-9(2)3;;;/h9-10H,5-8H2,1-4H3;2*1H;/q;;;+2/p-2 |
| InChIKey | RARJGFLKDQAXRM-UHFFFAOYSA-L |
| XLogP | -2.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze magnesium;2,6-dimethyloctane;dibromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;2,6-dimethyloctane;dibromide?
The IUPAC name of magnesium;2,6-dimethyloctane;dibromide (CID 175146229) is magnesium;2,6-dimethyloctane;dibromide.
What is the SMILES notation for magnesium;2,6-dimethyloctane;dibromide?
The canonical SMILES for magnesium;2,6-dimethyloctane;dibromide is CCC(C)CCCC(C)C.[Br-].[Br-].[Mg+2].
What is the InChIKey of magnesium;2,6-dimethyloctane;dibromide?
The InChIKey is RARJGFLKDQAXRM-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H22.2BrH.Mg/c1-5-10(4)8-6-7-9(2)3;;;/h9-10H,5-8H2,1-4H3;2*1H;/q;;;+2/p-2.
What are the key properties of magnesium;2,6-dimethyloctane;dibromide?
magnesium;2,6-dimethyloctane;dibromide has a molecular weight of 326.40 g/mol, XLogP of -2.51, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;2,6-dimethyloctane;dibromide is sourced from PubChem (CID 175146229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).