About magnesium;3-methyloctane;dibromide
magnesium;3-methyloctane;dibromide (PubChem CID 174825221) has the molecular formula C9H20Br2Mg
and a molecular weight of 312.37 g/mol. Its IUPAC name is magnesium;3-methyloctane;dibromide.
Molecular Properties
| Compound Name | magnesium;3-methyloctane;dibromide |
| PubChem CID | 174825221 |
| Molecular Formula | C9H20Br2Mg |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | magnesium;3-methyloctane;dibromide |
| SMILES | CCCCCC(C)CC.[Br-].[Br-].[Mg+2] |
| InChI | InChI=1S/C9H20.2BrH.Mg/c1-4-6-7-8-9(3)5-2;;;/h9H,4-8H2,1-3H3;2*1H;/q;;;+2/p-2 |
| InChIKey | NQGUNADBMIHLMX-UHFFFAOYSA-L |
| XLogP | -2.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze magnesium;3-methyloctane;dibromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;3-methyloctane;dibromide?
The IUPAC name of magnesium;3-methyloctane;dibromide (CID 174825221) is magnesium;3-methyloctane;dibromide.
What is the SMILES notation for magnesium;3-methyloctane;dibromide?
The canonical SMILES for magnesium;3-methyloctane;dibromide is CCCCCC(C)CC.[Br-].[Br-].[Mg+2].
What is the InChIKey of magnesium;3-methyloctane;dibromide?
The InChIKey is NQGUNADBMIHLMX-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H20.2BrH.Mg/c1-4-6-7-8-9(3)5-2;;;/h9H,4-8H2,1-3H3;2*1H;/q;;;+2/p-2.
What are the key properties of magnesium;3-methyloctane;dibromide?
magnesium;3-methyloctane;dibromide has a molecular weight of 312.37 g/mol, XLogP of -2.76, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;3-methyloctane;dibromide is sourced from PubChem (CID 174825221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).