C10H22O — CID 7792
3,7-dimethyloctan-1-ol (PubChem CID 7792) has the molecular formula C10H22O and a molecular weight of 158.28 g/mol. Its IUPAC name is 3,7-dimethyloctan-1-ol.
| Compound Name | 3,7-dimethyloctan-1-ol |
|---|---|
| PubChem CID | 7792 |
| Molecular Formula | C10H22O |
| Molecular Weight | 158.28 g/mol |
| Exact Mass | 158.17 |
| IUPAC Name | 3,7-dimethyloctan-1-ol |
| SMILES | CC(C)CCCC(C)CCO |
| InChI | InChI=1S/C10H22O/c1-9(2)5-4-6-10(3)7-8-11/h9-11H,4-8H2,1-3H3 |
| InChIKey | PRNCMAKCNVRZFX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |