C42H86O — CID 123449915
5,9,13,17-tetramethyl-2-(3,7,11,15-tetramethylhexadecyl)octadecan-1-ol (PubChem CID 123449915) has the molecular formula C42H86O and a molecular weight of 607.15 g/mol. Its IUPAC name is 5,9,13,17-tetramethyl-2-(3,7,11,15-tetramethylhexadecyl)octadecan-1-ol.
| Compound Name | 5,9,13,17-tetramethyl-2-(3,7,11,15-tetramethylhexadecyl)octadecan-1-ol |
|---|---|
| PubChem CID | 123449915 |
| Molecular Formula | C42H86O |
| Molecular Weight | 607.15 g/mol |
| Exact Mass | 606.67 |
| IUPAC Name | 5,9,13,17-tetramethyl-2-(3,7,11,15-tetramethylhexadecyl)octadecan-1-ol |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CCC(CO)CCC(C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C42H86O/c1-34(2)17-11-19-36(5)21-13-23-38(7)25-15-27-40(9)29-31-42(33-43)32-30-41(10)28-16-26-39(8)24-14-22-37(6)20-12-18-35(3)4/h34-43H,11-33H2,1-10H3 |
| InChIKey | JUONLLQJLAYGQQ-UHFFFAOYSA-N |
| XLogP | 14.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.15 |
| LogP ≤ 5 | 14.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |