C38H78O2 — CID 163028107
3,7,11,15,18,22,26-heptamethylhentriacontane-1,30-diol (PubChem CID 163028107) has the molecular formula C38H78O2 and a molecular weight of 567.04 g/mol. Its IUPAC name is 3,7,11,15,18,22,26-heptamethylhentriacontane-1,30-diol.
| Compound Name | 3,7,11,15,18,22,26-heptamethylhentriacontane-1,30-diol |
|---|---|
| PubChem CID | 163028107 |
| Molecular Formula | C38H78O2 |
| Molecular Weight | 567.04 g/mol |
| Exact Mass | 566.60 |
| IUPAC Name | 3,7,11,15,18,22,26-heptamethylhentriacontane-1,30-diol |
| SMILES | CC(O)CCCC(C)CCCC(C)CCCC(C)CCC(C)CCCC(C)CCCC(C)CCCC(C)CCO |
| InChI | InChI=1S/C38H78O2/c1-31(15-9-16-33(3)21-13-24-37(7)29-30-39)19-11-22-35(5)27-28-36(6)23-12-20-32(2)17-10-18-34(4)25-14-26-38(8)40/h31-40H,9-30H2,1-8H3 |
| InChIKey | REHHTTZGVFZENS-UHFFFAOYSA-N |
| XLogP | 12.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.04 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |