C8H20O4 — CID 18381145
butane-1,3-diol;butane-1,4-diol (PubChem CID 18381145) has the molecular formula C8H20O4 and a molecular weight of 180.24 g/mol. Its IUPAC name is butane-1,3-diol;butane-1,4-diol.
| Compound Name | butane-1,3-diol;butane-1,4-diol |
|---|---|
| PubChem CID | 18381145 |
| Molecular Formula | C8H20O4 |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | butane-1,3-diol;butane-1,4-diol |
| SMILES | CC(O)CCO.OCCCCO |
| InChI | InChI=1S/2C4H10O2/c1-4(6)2-3-5;5-3-1-2-4-6/h4-6H,2-3H2,1H3;5-6H,1-4H2 |
| InChIKey | WUAIVKFIBCXSJI-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|