C9H20O4 — CID 175133260
hexane-1,5-diol;propanoic acid (PubChem CID 175133260) has the molecular formula C9H20O4 and a molecular weight of 192.25 g/mol. Its IUPAC name is hexane-1,5-diol;propanoic acid.
| Compound Name | hexane-1,5-diol;propanoic acid |
|---|---|
| PubChem CID | 175133260 |
| Molecular Formula | C9H20O4 |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | hexane-1,5-diol;propanoic acid |
| SMILES | CC(O)CCCCO.CCC(=O)O |
| InChI | InChI=1S/C6H14O2.C3H6O2/c1-6(8)4-2-3-5-7;1-2-3(4)5/h6-8H,2-5H2,1H3;2H2,1H3,(H,4,5) |
| InChIKey | FEYDTDWBICWRCW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|