C7H18N2 — CID 18314368
2-methylhexane-1,5-diamine (PubChem CID 18314368) has the molecular formula C7H18N2 and a molecular weight of 130.23 g/mol. Its IUPAC name is 2-methylhexane-1,5-diamine.
| Compound Name | 2-methylhexane-1,5-diamine |
|---|---|
| PubChem CID | 18314368 |
| Molecular Formula | C7H18N2 |
| Molecular Weight | 130.23 g/mol |
| Exact Mass | 130.15 |
| IUPAC Name | 2-methylhexane-1,5-diamine |
| SMILES | CC(N)CCC(C)CN |
| InChI | InChI=1S/C7H18N2/c1-6(5-8)3-4-7(2)9/h6-7H,3-5,8-9H2,1-2H3 |
| InChIKey | VQGRILOLJITFOR-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.23 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |