About 6-methylheptane-1,2,3,7-tetramine
6-methylheptane-1,2,3,7-tetramine (PubChem CID 91329545) has the molecular formula C8H22N4
and a molecular weight of 174.29 g/mol. Its IUPAC name is 6-methylheptane-1,2,3,7-tetramine.
Molecular Properties
| Compound Name | 6-methylheptane-1,2,3,7-tetramine |
| PubChem CID | 91329545 |
| Molecular Formula | C8H22N4 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.18 |
| IUPAC Name | 6-methylheptane-1,2,3,7-tetramine |
| SMILES | CC(CN)CCC(N)C(N)CN |
| InChI | InChI=1S/C8H22N4/c1-6(4-9)2-3-7(11)8(12)5-10/h6-8H,2-5,9-12H2,1H3 |
| InChIKey | ZWGFEKUEARHFHG-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methylheptane-1,2,3,7-tetramine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylheptane-1,2,3,7-tetramine?
The IUPAC name of 6-methylheptane-1,2,3,7-tetramine (CID 91329545) is 6-methylheptane-1,2,3,7-tetramine.
What is the SMILES notation for 6-methylheptane-1,2,3,7-tetramine?
The canonical SMILES for 6-methylheptane-1,2,3,7-tetramine is CC(CN)CCC(N)C(N)CN.
What is the InChIKey of 6-methylheptane-1,2,3,7-tetramine?
The InChIKey is ZWGFEKUEARHFHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H22N4/c1-6(4-9)2-3-7(11)8(12)5-10/h6-8H,2-5,9-12H2,1H3.
What are the key properties of 6-methylheptane-1,2,3,7-tetramine?
6-methylheptane-1,2,3,7-tetramine has a molecular weight of 174.29 g/mol, XLogP of -1.03, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylheptane-1,2,3,7-tetramine is sourced from PubChem (CID 91329545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).