C8H22N4 — CID 91329545
6-methylheptane-1,2,3,7-tetramine (PubChem CID 91329545) has the molecular formula C8H22N4 and a molecular weight of 174.29 g/mol. Its IUPAC name is 6-methylheptane-1,2,3,7-tetramine.
| Compound Name | 6-methylheptane-1,2,3,7-tetramine |
|---|---|
| PubChem CID | 91329545 |
| Molecular Formula | C8H22N4 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.18 |
| IUPAC Name | 6-methylheptane-1,2,3,7-tetramine |
| SMILES | CC(CN)CCC(N)C(N)CN |
| InChI | InChI=1S/C8H22N4/c1-6(4-9)2-3-7(11)8(12)5-10/h6-8H,2-5,9-12H2,1H3 |
| InChIKey | ZWGFEKUEARHFHG-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |