C11H30N4 — CID 22378492
2-methylpentane-1,5-diamine;pentane-1,5-diamine (PubChem CID 22378492) has the molecular formula C11H30N4 and a molecular weight of 218.39 g/mol. Its IUPAC name is 2-methylpentane-1,5-diamine;pentane-1,5-diamine.
| Compound Name | 2-methylpentane-1,5-diamine;pentane-1,5-diamine |
|---|---|
| PubChem CID | 22378492 |
| Molecular Formula | C11H30N4 |
| Molecular Weight | 218.39 g/mol |
| Exact Mass | 218.25 |
| IUPAC Name | 2-methylpentane-1,5-diamine;pentane-1,5-diamine |
| SMILES | CC(CN)CCCN.NCCCCCN |
| InChI | InChI=1S/C6H16N2.C5H14N2/c1-6(5-8)3-2-4-7;6-4-2-1-3-5-7/h6H,2-5,7-8H2,1H3;1-7H2 |
| InChIKey | FMALOGQBXXBYMD-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.39 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|