C10H23N — CID 123439711
4,7-dimethyloctan-1-amine (PubChem CID 123439711) has the molecular formula C10H23N and a molecular weight of 157.30 g/mol. Its IUPAC name is 4,7-dimethyloctan-1-amine.
| Compound Name | 4,7-dimethyloctan-1-amine |
|---|---|
| PubChem CID | 123439711 |
| Molecular Formula | C10H23N |
| Molecular Weight | 157.30 g/mol |
| Exact Mass | 157.18 |
| IUPAC Name | 4,7-dimethyloctan-1-amine |
| SMILES | CC(C)CCC(C)CCCN |
| InChI | InChI=1S/C10H23N/c1-9(2)6-7-10(3)5-4-8-11/h9-10H,4-8,11H2,1-3H3 |
| InChIKey | RDAQLXSBFIRSCT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |