C12H29N3 — CID 23599731
N'-(3-aminopropyl)-4-methyloctane-1,8-diamine (PubChem CID 23599731) has the molecular formula C12H29N3 and a molecular weight of 215.38 g/mol. Its IUPAC name is N'-(3-aminopropyl)-4-methyloctane-1,8-diamine.
| Compound Name | N'-(3-aminopropyl)-4-methyloctane-1,8-diamine |
|---|---|
| PubChem CID | 23599731 |
| Molecular Formula | C12H29N3 |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.24 |
| IUPAC Name | N'-(3-aminopropyl)-4-methyloctane-1,8-diamine |
| SMILES | CC(CCCN)CCCCNCCCN |
| InChI | InChI=1S/C12H29N3/c1-12(7-4-8-13)6-2-3-10-15-11-5-9-14/h12,15H,2-11,13-14H2,1H3 |
| InChIKey | KUQXCUNSNBGWHY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|