C9H23N3 — CID 91335741
1-N-(4-aminobutyl)pentane-1,4-diamine (PubChem CID 91335741) has the molecular formula C9H23N3 and a molecular weight of 173.30 g/mol. Its IUPAC name is 1-N-(4-aminobutyl)pentane-1,4-diamine.
| Compound Name | 1-N-(4-aminobutyl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 91335741 |
| Molecular Formula | C9H23N3 |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.19 |
| IUPAC Name | 1-N-(4-aminobutyl)pentane-1,4-diamine |
| SMILES | CC(N)CCCNCCCCN |
| InChI | InChI=1S/C9H23N3/c1-9(11)5-4-8-12-7-3-2-6-10/h9,12H,2-8,10-11H2,1H3 |
| InChIKey | PZDCZNXFNIASME-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|