C14H33N3 — CID 177154486
(3R)-N'-(3-aminopropyl)-2,3,6-trimethyloctane-1,8-diamine (PubChem CID 177154486) has the molecular formula C14H33N3 and a molecular weight of 243.44 g/mol. Its IUPAC name is (3R)-N'-(3-aminopropyl)-2,3,6-trimethyloctane-1,8-diamine.
| Compound Name | (3R)-N'-(3-aminopropyl)-2,3,6-trimethyloctane-1,8-diamine |
|---|---|
| PubChem CID | 177154486 |
| Molecular Formula | C14H33N3 |
| Molecular Weight | 243.44 g/mol |
| Exact Mass | 243.27 |
| IUPAC Name | (3R)-N'-(3-aminopropyl)-2,3,6-trimethyloctane-1,8-diamine |
| SMILES | CC(CCNCCCN)CC[C@@H](C)C(C)CN |
| InChI | InChI=1S/C14H33N3/c1-12(7-10-17-9-4-8-15)5-6-13(2)14(3)11-16/h12-14,17H,4-11,15-16H2,1-3H3/t12?,13-,14?/m1/s1 |
| InChIKey | FQXOAONUEQTZOD-ROKHWSDSSA-N |
| XLogP | 1.96 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.44 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|