C12H30N4 — CID 142765036
N-(4-aminobutan-2-yl)-N'-(3-aminopropyl)-2-methylbutane-1,4-diamine (PubChem CID 142765036) has the molecular formula C12H30N4 and a molecular weight of 230.40 g/mol. Its IUPAC name is N-(4-aminobutan-2-yl)-N'-(3-aminopropyl)-2-methylbutane-1,4-diamine.
| Compound Name | N-(4-aminobutan-2-yl)-N'-(3-aminopropyl)-2-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 142765036 |
| Molecular Formula | C12H30N4 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.25 |
| IUPAC Name | N-(4-aminobutan-2-yl)-N'-(3-aminopropyl)-2-methylbutane-1,4-diamine |
| SMILES | CC(CCNCCCN)CNC(C)CCN |
| InChI | InChI=1S/C12H30N4/c1-11(5-9-15-8-3-6-13)10-16-12(2)4-7-14/h11-12,15-16H,3-10,13-14H2,1-2H3 |
| InChIKey | FKIVTLRMMWMLHR-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|