C16H42Cl4N4 — CID 10181201
3-N-ethyl-1-N-[4-[3-(ethylamino)butylamino]butyl]butane-1,3-diamine;tetrahydrochloride (PubChem CID 10181201) has the molecular formula C16H42Cl4N4 and a molecular weight of 432.35 g/mol. Its IUPAC name is 3-N-ethyl-1-N-[4-[3-(ethylamino)butylamino]butyl]butane-1,3-diamine;tetrahydrochloride.
| Compound Name | 3-N-ethyl-1-N-[4-[3-(ethylamino)butylamino]butyl]butane-1,3-diamine;tetrahydrochloride |
|---|---|
| PubChem CID | 10181201 |
| Molecular Formula | C16H42Cl4N4 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 3-N-ethyl-1-N-[4-[3-(ethylamino)butylamino]butyl]butane-1,3-diamine;tetrahydrochloride |
| SMILES | CCNC(C)CCNCCCCNCCC(C)NCC.Cl.Cl.Cl.Cl |
| InChI | InChI=1S/C16H38N4.4ClH/c1-5-19-15(3)9-13-17-11-7-8-12-18-14-10-16(4)20-6-2;;;;/h15-20H,5-14H2,1-4H3;4*1H |
| InChIKey | FAMBGXZZUWNTJF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|