C16H38N4 — CID 87772787
4-N-[4-(butylamino)butyl]-1-N,1-N'-diethylbutane-1,1,4-triamine (PubChem CID 87772787) has the molecular formula C16H38N4 and a molecular weight of 286.51 g/mol. Its IUPAC name is 4-N-[4-(butylamino)butyl]-1-N,1-N'-diethylbutane-1,1,4-triamine.
| Compound Name | 4-N-[4-(butylamino)butyl]-1-N,1-N'-diethylbutane-1,1,4-triamine |
|---|---|
| PubChem CID | 87772787 |
| Molecular Formula | C16H38N4 |
| Molecular Weight | 286.51 g/mol |
| Exact Mass | 286.31 |
| IUPAC Name | 4-N-[4-(butylamino)butyl]-1-N,1-N'-diethylbutane-1,1,4-triamine |
| SMILES | CCCCNCCCCNCCCC(NCC)NCC |
| InChI | InChI=1S/C16H38N4/c1-4-7-12-17-13-8-9-14-18-15-10-11-16(19-5-2)20-6-3/h16-20H,4-15H2,1-3H3 |
| InChIKey | DTTWKJLEHAKVNO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.51 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|