C17H44Cl4N4 — CID 173339622
1-N,1-N'-bis[3-(ethylamino)propyl]heptane-1,1-diamine;tetrahydrochloride (PubChem CID 173339622) has the molecular formula C17H44Cl4N4 and a molecular weight of 446.38 g/mol. Its IUPAC name is 1-N,1-N'-bis[3-(ethylamino)propyl]heptane-1,1-diamine;tetrahydrochloride.
| Compound Name | 1-N,1-N'-bis[3-(ethylamino)propyl]heptane-1,1-diamine;tetrahydrochloride |
|---|---|
| PubChem CID | 173339622 |
| Molecular Formula | C17H44Cl4N4 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 1-N,1-N'-bis[3-(ethylamino)propyl]heptane-1,1-diamine;tetrahydrochloride |
| SMILES | CCCCCCC(NCCCNCC)NCCCNCC.Cl.Cl.Cl.Cl |
| InChI | InChI=1S/C17H40N4.4ClH/c1-4-7-8-9-12-17(20-15-10-13-18-5-2)21-16-11-14-19-6-3;;;;/h17-21H,4-16H2,1-3H3;4*1H |
| InChIKey | OEDQRKOQODSVBC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|