C14H34N4 — CID 57162858
1-N,1-N'-bis(3-aminopropyl)octane-1,1-diamine (PubChem CID 57162858) has the molecular formula C14H34N4 and a molecular weight of 258.45 g/mol. Its IUPAC name is 1-N,1-N'-bis(3-aminopropyl)octane-1,1-diamine.
| Compound Name | 1-N,1-N'-bis(3-aminopropyl)octane-1,1-diamine |
|---|---|
| PubChem CID | 57162858 |
| Molecular Formula | C14H34N4 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.28 |
| IUPAC Name | 1-N,1-N'-bis(3-aminopropyl)octane-1,1-diamine |
| SMILES | CCCCCCCC(NCCCN)NCCCN |
| InChI | InChI=1S/C14H34N4/c1-2-3-4-5-6-9-14(17-12-7-10-15)18-13-8-11-16/h14,17-18H,2-13,15-16H2,1H3 |
| InChIKey | CCDRUWKTMMVCCG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|