C17H38N2 — CID 175187271
N'-dodecan-2-ylpentane-1,5-diamine (PubChem CID 175187271) has the molecular formula C17H38N2 and a molecular weight of 270.50 g/mol. Its IUPAC name is N'-dodecan-2-ylpentane-1,5-diamine.
| Compound Name | N'-dodecan-2-ylpentane-1,5-diamine |
|---|---|
| PubChem CID | 175187271 |
| Molecular Formula | C17H38N2 |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.30 |
| IUPAC Name | N'-dodecan-2-ylpentane-1,5-diamine |
| SMILES | CCCCCCCCCCC(C)NCCCCCN |
| InChI | InChI=1S/C17H38N2/c1-3-4-5-6-7-8-9-11-14-17(2)19-16-13-10-12-15-18/h17,19H,3-16,18H2,1-2H3 |
| InChIKey | YFRBDXOZFVGCLX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|