About N-butylundecan-2-amine
N-butylundecan-2-amine (PubChem CID 90035852) has the molecular formula C15H33N
and a molecular weight of 227.44 g/mol. Its IUPAC name is N-butylundecan-2-amine.
Molecular Properties
| Compound Name | N-butylundecan-2-amine |
| PubChem CID | 90035852 |
| Molecular Formula | C15H33N |
| Molecular Weight | 227.44 g/mol |
| Exact Mass | 227.26 |
| IUPAC Name | N-butylundecan-2-amine |
| SMILES | CCCCCCCCCC(C)NCCCC |
| InChI | InChI=1S/C15H33N/c1-4-6-8-9-10-11-12-13-15(3)16-14-7-5-2/h15-16H,4-14H2,1-3H3 |
| InChIKey | GAIVSHMCRIUQJH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butylundecan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butylundecan-2-amine?
The IUPAC name of N-butylundecan-2-amine (CID 90035852) is N-butylundecan-2-amine.
What is the SMILES notation for N-butylundecan-2-amine?
The canonical SMILES for N-butylundecan-2-amine is CCCCCCCCCC(C)NCCCC.
What is the InChIKey of N-butylundecan-2-amine?
The InChIKey is GAIVSHMCRIUQJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33N/c1-4-6-8-9-10-11-12-13-15(3)16-14-7-5-2/h15-16H,4-14H2,1-3H3.
What are the key properties of N-butylundecan-2-amine?
N-butylundecan-2-amine has a molecular weight of 227.44 g/mol, XLogP of 4.91, 12 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butylundecan-2-amine is sourced from PubChem (CID 90035852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).