C22H48N2 — CID 166889423
N-heptadecan-2-yl-N',N'-dimethylpropane-1,3-diamine (PubChem CID 166889423) has the molecular formula C22H48N2 and a molecular weight of 340.64 g/mol. Its IUPAC name is N-heptadecan-2-yl-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-heptadecan-2-yl-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 166889423 |
| Molecular Formula | C22H48N2 |
| Molecular Weight | 340.64 g/mol |
| Exact Mass | 340.38 |
| IUPAC Name | N-heptadecan-2-yl-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CCCCCCCCCCCCCCCC(C)NCCCN(C)C |
| InChI | InChI=1S/C22H48N2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-19-22(2)23-20-18-21-24(3)4/h22-23H,5-21H2,1-4H3 |
| InChIKey | TYFIVHIHRMGCEY-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.64 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|