C19H44N4 — CID 90853445
N'-(3-aminopropyl)-N'-[3-(decan-2-ylamino)propyl]propane-1,3-diamine (PubChem CID 90853445) has the molecular formula C19H44N4 and a molecular weight of 328.59 g/mol. Its IUPAC name is N'-(3-aminopropyl)-N'-[3-(decan-2-ylamino)propyl]propane-1,3-diamine.
| Compound Name | N'-(3-aminopropyl)-N'-[3-(decan-2-ylamino)propyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 90853445 |
| Molecular Formula | C19H44N4 |
| Molecular Weight | 328.59 g/mol |
| Exact Mass | 328.36 |
| IUPAC Name | N'-(3-aminopropyl)-N'-[3-(decan-2-ylamino)propyl]propane-1,3-diamine |
| SMILES | CCCCCCCCC(C)NCCCN(CCCN)CCCN |
| InChI | InChI=1S/C19H44N4/c1-3-4-5-6-7-8-12-19(2)22-15-11-18-23(16-9-13-20)17-10-14-21/h19,22H,3-18,20-21H2,1-2H3 |
| InChIKey | IDORSLZNAXBMLV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.59 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|