About 4-hexylundecan-1-amine
4-hexylundecan-1-amine (PubChem CID 167174040) has the molecular formula C17H37N
and a molecular weight of 255.49 g/mol. Its IUPAC name is 4-hexylundecan-1-amine.
Molecular Properties
| Compound Name | 4-hexylundecan-1-amine |
| PubChem CID | 167174040 |
| Molecular Formula | C17H37N |
| Molecular Weight | 255.49 g/mol |
| Exact Mass | 255.29 |
| IUPAC Name | 4-hexylundecan-1-amine |
| SMILES | CCCCCCCC(CCCN)CCCCCC |
| InChI | InChI=1S/C17H37N/c1-3-5-7-9-11-14-17(15-12-16-18)13-10-8-6-4-2/h17H,3-16,18H2,1-2H3 |
| InChIKey | RMXAPPOOWQWUOP-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 255.49 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-hexylundecan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexylundecan-1-amine?
The IUPAC name of 4-hexylundecan-1-amine (CID 167174040) is 4-hexylundecan-1-amine.
What is the SMILES notation for 4-hexylundecan-1-amine?
The canonical SMILES for 4-hexylundecan-1-amine is CCCCCCCC(CCCN)CCCCCC.
What is the InChIKey of 4-hexylundecan-1-amine?
The InChIKey is RMXAPPOOWQWUOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H37N/c1-3-5-7-9-11-14-17(15-12-16-18)13-10-8-6-4-2/h17H,3-16,18H2,1-2H3.
What are the key properties of 4-hexylundecan-1-amine?
4-hexylundecan-1-amine has a molecular weight of 255.49 g/mol, XLogP of 5.67, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexylundecan-1-amine is sourced from PubChem (CID 167174040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).