About 8-heptyloctadecane
8-heptyloctadecane (PubChem CID 173205504) has the molecular formula C25H52
and a molecular weight of 352.69 g/mol. Its IUPAC name is 8-heptyloctadecane.
Molecular Properties
| Compound Name | 8-heptyloctadecane |
| PubChem CID | 173205504 |
| Molecular Formula | C25H52 |
| Molecular Weight | 352.69 g/mol |
| Exact Mass | 352.41 |
| IUPAC Name | 8-heptyloctadecane |
| SMILES | CCCCCCCCCCC(CCCCCCC)CCCCCCC |
| InChI | InChI=1S/C25H52/c1-4-7-10-13-14-15-18-21-24-25(22-19-16-11-8-5-2)23-20-17-12-9-6-3/h25H,4-24H2,1-3H3 |
| InChIKey | JYQGZUFWVAJVEU-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 21 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.69 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-heptyloctadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-heptyloctadecane?
The IUPAC name of 8-heptyloctadecane (CID 173205504) is 8-heptyloctadecane.
What is the SMILES notation for 8-heptyloctadecane?
The canonical SMILES for 8-heptyloctadecane is CCCCCCCCCCC(CCCCCCC)CCCCCCC.
What is the InChIKey of 8-heptyloctadecane?
The InChIKey is JYQGZUFWVAJVEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H52/c1-4-7-10-13-14-15-18-21-24-25(22-19-16-11-8-5-2)23-20-17-12-9-6-3/h25H,4-24H2,1-3H3.
What are the key properties of 8-heptyloctadecane?
8-heptyloctadecane has a molecular weight of 352.69 g/mol, XLogP of 9.85, 21 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 8-heptyloctadecane is sourced from PubChem (CID 173205504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).