About 7-pentylnonadecane
7-pentylnonadecane (PubChem CID 59903423) has the molecular formula C24H50
and a molecular weight of 338.66 g/mol. Its IUPAC name is 7-pentylnonadecane.
Molecular Properties
| Compound Name | 7-pentylnonadecane |
| PubChem CID | 59903423 |
| Molecular Formula | C24H50 |
| Molecular Weight | 338.66 g/mol |
| Exact Mass | 338.39 |
| IUPAC Name | 7-pentylnonadecane |
| SMILES | CCCCCCCCCCCCC(CCCCC)CCCCCC |
| InChI | InChI=1S/C24H50/c1-4-7-10-12-13-14-15-16-17-20-23-24(21-18-9-6-3)22-19-11-8-5-2/h24H,4-23H2,1-3H3 |
| InChIKey | MPICCBOTSNVPJA-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.66 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-pentylnonadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-pentylnonadecane?
The IUPAC name of 7-pentylnonadecane (CID 59903423) is 7-pentylnonadecane.
What is the SMILES notation for 7-pentylnonadecane?
The canonical SMILES for 7-pentylnonadecane is CCCCCCCCCCCCC(CCCCC)CCCCCC.
What is the InChIKey of 7-pentylnonadecane?
The InChIKey is MPICCBOTSNVPJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H50/c1-4-7-10-12-13-14-15-16-17-20-23-24(21-18-9-6-3)22-19-11-8-5-2/h24H,4-23H2,1-3H3.
What are the key properties of 7-pentylnonadecane?
7-pentylnonadecane has a molecular weight of 338.66 g/mol, XLogP of 9.46, 20 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-pentylnonadecane is sourced from PubChem (CID 59903423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).