C13H30N2 — CID 126574797
1-N,4-N-diethylnonane-1,4-diamine (PubChem CID 126574797) has the molecular formula C13H30N2 and a molecular weight of 214.40 g/mol. Its IUPAC name is 1-N,4-N-diethylnonane-1,4-diamine.
| Compound Name | 1-N,4-N-diethylnonane-1,4-diamine |
|---|---|
| PubChem CID | 126574797 |
| Molecular Formula | C13H30N2 |
| Molecular Weight | 214.40 g/mol |
| Exact Mass | 214.24 |
| IUPAC Name | 1-N,4-N-diethylnonane-1,4-diamine |
| SMILES | CCCCCC(CCCNCC)NCC |
| InChI | InChI=1S/C13H30N2/c1-4-7-8-10-13(15-6-3)11-9-12-14-5-2/h13-15H,4-12H2,1-3H3 |
| InChIKey | DAESFPQRBIIPPU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|