About N-ethyldecan-3-amine;dihydrochloride
N-ethyldecan-3-amine;dihydrochloride (PubChem CID 175708733) has the molecular formula C12H29Cl2N
and a molecular weight of 258.28 g/mol. Its IUPAC name is N-ethyldecan-3-amine;dihydrochloride.
Molecular Properties
| Compound Name | N-ethyldecan-3-amine;dihydrochloride |
| PubChem CID | 175708733 |
| Molecular Formula | C12H29Cl2N |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | N-ethyldecan-3-amine;dihydrochloride |
| SMILES | CCCCCCCC(CC)NCC.Cl.Cl |
| InChI | InChI=1S/C12H27N.2ClH/c1-4-7-8-9-10-11-12(5-2)13-6-3;;/h12-13H,4-11H2,1-3H3;2*1H |
| InChIKey | LMUWTNYASAULON-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-ethyldecan-3-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyldecan-3-amine;dihydrochloride?
The IUPAC name of N-ethyldecan-3-amine;dihydrochloride (CID 175708733) is N-ethyldecan-3-amine;dihydrochloride.
What is the SMILES notation for N-ethyldecan-3-amine;dihydrochloride?
The canonical SMILES for N-ethyldecan-3-amine;dihydrochloride is CCCCCCCC(CC)NCC.Cl.Cl.
What is the InChIKey of N-ethyldecan-3-amine;dihydrochloride?
The InChIKey is LMUWTNYASAULON-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N.2ClH/c1-4-7-8-9-10-11-12(5-2)13-6-3;;/h12-13H,4-11H2,1-3H3;2*1H.
What are the key properties of N-ethyldecan-3-amine;dihydrochloride?
N-ethyldecan-3-amine;dihydrochloride has a molecular weight of 258.28 g/mol, XLogP of 4.58, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyldecan-3-amine;dihydrochloride is sourced from PubChem (CID 175708733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).