About N-ethylhexadecan-4-amine
N-ethylhexadecan-4-amine (PubChem CID 63413885) has the molecular formula C18H39N
and a molecular weight of 269.52 g/mol. Its IUPAC name is N-ethylhexadecan-4-amine.
Molecular Properties
| Compound Name | N-ethylhexadecan-4-amine |
| PubChem CID | 63413885 |
| Molecular Formula | C18H39N |
| Molecular Weight | 269.52 g/mol |
| Exact Mass | 269.31 |
| IUPAC Name | N-ethylhexadecan-4-amine |
| SMILES | CCCCCCCCCCCCC(CCC)NCC |
| InChI | InChI=1S/C18H39N/c1-4-7-8-9-10-11-12-13-14-15-17-18(16-5-2)19-6-3/h18-19H,4-17H2,1-3H3 |
| InChIKey | VQCOFZJWOSEULA-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 269.52 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-ethylhexadecan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylhexadecan-4-amine?
The IUPAC name of N-ethylhexadecan-4-amine (CID 63413885) is N-ethylhexadecan-4-amine.
What is the SMILES notation for N-ethylhexadecan-4-amine?
The canonical SMILES for N-ethylhexadecan-4-amine is CCCCCCCCCCCCC(CCC)NCC.
What is the InChIKey of N-ethylhexadecan-4-amine?
The InChIKey is VQCOFZJWOSEULA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H39N/c1-4-7-8-9-10-11-12-13-14-15-17-18(16-5-2)19-6-3/h18-19H,4-17H2,1-3H3.
What are the key properties of N-ethylhexadecan-4-amine?
N-ethylhexadecan-4-amine has a molecular weight of 269.52 g/mol, XLogP of 6.08, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylhexadecan-4-amine is sourced from PubChem (CID 63413885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).