C20H47N5 — CID 87771515
1-N'-[4-(butylamino)butyl]-1-N-ethyl-4-N-[4-(ethylamino)butyl]butane-1,1,4-triamine (PubChem CID 87771515) has the molecular formula C20H47N5 and a molecular weight of 357.63 g/mol. Its IUPAC name is 1-N'-[4-(butylamino)butyl]-1-N-ethyl-4-N-[4-(ethylamino)butyl]butane-1,1,4-triamine.
| Compound Name | 1-N'-[4-(butylamino)butyl]-1-N-ethyl-4-N-[4-(ethylamino)butyl]butane-1,1,4-triamine |
|---|---|
| PubChem CID | 87771515 |
| Molecular Formula | C20H47N5 |
| Molecular Weight | 357.63 g/mol |
| Exact Mass | 357.38 |
| IUPAC Name | 1-N'-[4-(butylamino)butyl]-1-N-ethyl-4-N-[4-(ethylamino)butyl]butane-1,1,4-triamine |
| SMILES | CCCCNCCCCNC(CCCNCCCCNCC)NCC |
| InChI | InChI=1S/C20H47N5/c1-4-7-14-22-17-10-11-19-25-20(24-6-3)13-12-18-23-16-9-8-15-21-5-2/h20-25H,4-19H2,1-3H3 |
| InChIKey | XHIDKWYGURNKSB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.63 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|