C16H38N4V — CID 161302132
3-N-ethyl-1-N-[4-[3-(ethylamino)butylamino]butyl]butane-1,3-diamine;vanadium (PubChem CID 161302132) has the molecular formula C16H38N4V and a molecular weight of 337.45 g/mol. Its IUPAC name is 3-N-ethyl-1-N-[4-[3-(ethylamino)butylamino]butyl]butane-1,3-diamine;vanadium.
| Compound Name | 3-N-ethyl-1-N-[4-[3-(ethylamino)butylamino]butyl]butane-1,3-diamine;vanadium |
|---|---|
| PubChem CID | 161302132 |
| Molecular Formula | C16H38N4V |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.25 |
| IUPAC Name | 3-N-ethyl-1-N-[4-[3-(ethylamino)butylamino]butyl]butane-1,3-diamine;vanadium |
| SMILES | CCNC(C)CCNCCCCNCCC(C)NCC.[V] |
| InChI | InChI=1S/C16H38N4.V/c1-5-19-15(3)9-13-17-11-7-8-12-18-14-10-16(4)20-6-2;/h15-20H,5-14H2,1-4H3; |
| InChIKey | VHTKYFPPJCOTKH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|